Products 1379292-20-2

CAS 1379292-20-2 is the registry number for Indobufen Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-nitrosophenyl)butanoic acid (CAS 1379292-20-2) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(4-nitrosophenyl)butanoic acid. InChIKey: MTDYDPHNCFWWAW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO3
Molecular weight193.20 g/mol
IUPAC name2-(4-nitrosophenyl)butanoic acid
InChIKeyMTDYDPHNCFWWAW-UHFFFAOYSA-N
SMILESCCC(C1=CC=C(C=C1)N=O)C(=O)O

Computed by PubChem (NCBI)