CAS 1379292-20-2 is the registry number for Indobufen Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-nitrosophenyl)butanoic acid (CAS 1379292-20-2) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(4-nitrosophenyl)butanoic acid. InChIKey: MTDYDPHNCFWWAW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-(4-nitrosophenyl)butanoic acid |
| InChIKey | MTDYDPHNCFWWAW-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)N=O)C(=O)O |
Computed by PubChem (NCBI)