CAS 1379337-73-1 appears in our catalog under these names: 2,4–Dichloro–6–nitropyridine, 2,4-Dichloro-6-nitropyridine 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg.
2,4-dichloro-6-nitropyridine (CAS 1379337-73-1) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,4-dichloro-6-nitropyridine. InChIKey: RHPOXXQUAPLUIU-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,4-dichloro-6-nitropyridine |
| InChIKey | RHPOXXQUAPLUIU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)