CAS 1379345-53-5 appears in our catalog under these names: 7-Bromo-3-hydroxyquinolin-2(1H)-one, 97%, 7-Bromo-3-hydroxyquinolin-2(1H)-one, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg.
7-bromo-3-hydroxy-1H-quinolin-2-one (CAS 1379345-53-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-3-hydroxy-1H-quinolin-2-one. InChIKey: GQIJNKFEPOJJJI-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-3-hydroxy-1H-quinolin-2-one |
| InChIKey | GQIJNKFEPOJJJI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)C(=C2)O |
Computed by PubChem (NCBI)