CAS 1379366-41-2 is the registry number for 6-Bromo-2,3-dimethoxybenzonitrile, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-bromo-2,3-dimethoxybenzonitrile (CAS 1379366-41-2) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-2,3-dimethoxybenzonitrile. InChIKey: NGJUELZZYSTFBR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-2,3-dimethoxybenzonitrile |
| InChIKey | NGJUELZZYSTFBR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C#N)OC |
Computed by PubChem (NCBI)