Products 1379435-25-2

CAS 1379435-25-2 is the registry number for 2-Aminoethyl Methyl Fumarate. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

4-O-(2-aminoethyl) 1-O-methyl (E)-but-2-enedioate (CAS 1379435-25-2) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: 4-O-(2-aminoethyl) 1-O-methyl (E)-but-2-enedioate. InChIKey: PFSIJVTXRXKSOQ-NSCUHMNNSA-N.

Identity
Molecular formulaC7H11NO4
Molecular weight173.17 g/mol
IUPAC name4-O-(2-aminoethyl) 1-O-methyl (E)-but-2-enedioate
InChIKeyPFSIJVTXRXKSOQ-NSCUHMNNSA-N
SMILESCOC(=O)/C=C/C(=O)OCCN

Computed by PubChem (NCBI)