CAS 1380300-62-8 appears in our catalog under these names: 4,4-Difluoro-1-(pyridin-4-ylmethyl)cyclohexane-1-carboxylic acid hydrochloride, 95%, 4,4-Difluoro-1-(pyridin-4-ylmethyl)cyclohexanecarboxylic acid hydrochloride, 95.0%, 95.0%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4,4-difluoro-1-(pyridin-4-ylmethyl)cyclohexane-1-carboxylic acid;hydrochloride (CAS 1380300-62-8) is a chemical compound with the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. IUPAC name: 4,4-difluoro-1-(pyridin-4-ylmethyl)cyclohexane-1-carboxylic acid;hydrochloride. InChIKey: OAAHOAWWXOSVFB-UHFFFAOYSA-N.
| Molecular formula | C13H16ClF2NO2 |
|---|---|
| Molecular weight | 291.72 g/mol |
| IUPAC name | 4,4-difluoro-1-(pyridin-4-ylmethyl)cyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | OAAHOAWWXOSVFB-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1(CC2=CC=NC=C2)C(=O)O)(F)F.Cl |
Computed by PubChem (NCBI)