CAS 2270911-58-3 is the registry number for 3-[(4,4-Difluoropiperidin-1-yl)methyl]benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride (CAS 2270911-58-3) is a chemical compound with the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. IUPAC name: 3-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride. InChIKey: RVZYBBFPTQDVEM-UHFFFAOYSA-N.
| Molecular formula | C13H16ClF2NO2 |
|---|---|
| Molecular weight | 291.72 g/mol |
| IUPAC name | 3-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride |
| InChIKey | RVZYBBFPTQDVEM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)CC2=CC(=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)