Products 2270911-58-3

CAS 2270911-58-3 is the registry number for 3-[(4,4-Difluoropiperidin-1-yl)methyl]benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride (CAS 2270911-58-3) is a chemical compound with the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. IUPAC name: 3-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride. InChIKey: RVZYBBFPTQDVEM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClF2NO2
Molecular weight291.72 g/mol
IUPAC name3-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride
InChIKeyRVZYBBFPTQDVEM-UHFFFAOYSA-N
SMILESC1CN(CCC1(F)F)CC2=CC(=CC=C2)C(=O)O.Cl

Computed by PubChem (NCBI)