CAS 1803588-54-6 is the registry number for 1-Benzyl-3,3-difluoropiperidine-4-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-benzyl-3,3-difluoropiperidine-4-carboxylic acid;hydrochloride (CAS 1803588-54-6) is a chemical compound with the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. IUPAC name: 1-benzyl-3,3-difluoropiperidine-4-carboxylic acid;hydrochloride. InChIKey: OVSIOYRMISCZSG-UHFFFAOYSA-N.
| Molecular formula | C13H16ClF2NO2 |
|---|---|
| Molecular weight | 291.72 g/mol |
| IUPAC name | 1-benzyl-3,3-difluoropiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | OVSIOYRMISCZSG-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1C(=O)O)(F)F)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)