CAS 2270910-75-1 is the registry number for Cyclopentyl-(2,2-difluoro-benzo[1,3]dioxol-4-ylmethyl)-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]cyclopentanamine;hydrochloride (CAS 2270910-75-1) is a chemical compound with the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. IUPAC name: N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]cyclopentanamine;hydrochloride. InChIKey: JHNCLJNNXXHZIG-UHFFFAOYSA-N.
| Molecular formula | C13H16ClF2NO2 |
|---|---|
| Molecular weight | 291.72 g/mol |
| IUPAC name | N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]cyclopentanamine;hydrochloride |
| InChIKey | JHNCLJNNXXHZIG-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NCC2=C3C(=CC=C2)OC(O3)(F)F.Cl |
Computed by PubChem (NCBI)