CAS 2270911-13-0 is the registry number for 4-[(4,4-Difluoropiperidin-1-yl)methyl]benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride (CAS 2270911-13-0) is a chemical compound with the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. IUPAC name: 4-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride. InChIKey: WUBOQWXHKHSIDU-UHFFFAOYSA-N.
| Molecular formula | C13H16ClF2NO2 |
|---|---|
| Molecular weight | 291.72 g/mol |
| IUPAC name | 4-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid;hydrochloride |
| InChIKey | WUBOQWXHKHSIDU-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)CC2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)