CAS 1803612-25-0 appears in our catalog under these names: 1-Benzyl-4,4-difluoropiperidine-3-carboxylic acid hydrochloride, 95%, 1-Benzyl-4,4-difluoropiperidine-3-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-benzyl-4,4-difluoropiperidine-3-carboxylic acid;hydrochloride (CAS 1803612-25-0) is a chemical compound with the molecular formula C13H16ClF2NO2 and a molecular weight of 291.72 g/mol. IUPAC name: 1-benzyl-4,4-difluoropiperidine-3-carboxylic acid;hydrochloride. InChIKey: QSTWQLABJNVIMX-UHFFFAOYSA-N.
| Molecular formula | C13H16ClF2NO2 |
|---|---|
| Molecular weight | 291.72 g/mol |
| IUPAC name | 1-benzyl-4,4-difluoropiperidine-3-carboxylic acid;hydrochloride |
| InChIKey | QSTWQLABJNVIMX-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1(F)F)C(=O)O)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)