Products 1381846-30-5
CAS 1381846-30-5 is the registry number for Methyl 5-(aminomethyl)-2-(difluoromethyl)benzoate hydrochloride, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
Methyl 5-(aminomethyl)-2-(difluoromethyl)benzoate;hydrochloride (CAS 1381846-30-5) is a chemical compound with the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 5-(aminomethyl)-2-(difluoromethyl)benzoate;hydrochloride. InChIKey: SNEHGNLHXYBVIO-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO2 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | methyl 5-(aminomethyl)-2-(difluoromethyl)benzoate;hydrochloride |
| InChIKey | SNEHGNLHXYBVIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)CN)C(F)F.Cl |
Computed by PubChem (NCBI)