CAS 1381944-22-4 is the registry number for 9H-Fluorene-3,9-diol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
9H-fluorene-3,9-diol (CAS 1381944-22-4) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 9H-fluorene-3,9-diol. InChIKey: MXVUUOPKYAQYPU-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 9H-fluorene-3,9-diol |
| InChIKey | MXVUUOPKYAQYPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=C2C=C(C=C3)O)O |
Computed by PubChem (NCBI)