CAS 138420-09-4 appears in our catalog under these names: Ethyl 2–(5–chlorobenzo(d)oxazol–2–yl)acetate, ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
Ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate (CAS 138420-09-4) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate. InChIKey: LIDLQLJDBGDIFT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | ethyl 2-(5-chloro-1,3-benzoxazol-2-yl)acetate |
| InChIKey | LIDLQLJDBGDIFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=C(O1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)