CAS 1384253-80-8 is the registry number for Methyl 6-Mesitylpicolinate. Offered by: TRC. Available pack sizes: 100mg.
Methyl 6-(2,4,6-trimethylphenyl)pyridine-2-carboxylate (CAS 1384253-80-8) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: methyl 6-(2,4,6-trimethylphenyl)pyridine-2-carboxylate. InChIKey: GBRPCALFNMXATQ-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | methyl 6-(2,4,6-trimethylphenyl)pyridine-2-carboxylate |
| InChIKey | GBRPCALFNMXATQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NC(=CC=C2)C(=O)OC)C |
Computed by PubChem (NCBI)