Products 1384429-70-2
CAS 1384429-70-2 is the registry number for 3-Iodoimidazo(1,2-a)pyridine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-iodoimidazo[1,2-a]pyridine-6-carboxylic acid (CAS 1384429-70-2) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodoimidazo[1,2-a]pyridine-6-carboxylic acid. InChIKey: UVCDOAAKEDNFOE-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodoimidazo[1,2-a]pyridine-6-carboxylic acid |
| InChIKey | UVCDOAAKEDNFOE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1C(=O)O)I |
Computed by PubChem (NCBI)