CAS 1385696-32-1 is the registry number for 5-Cyclobutoxypyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-cyclobutyloxypyridine-3-carboxylic acid (CAS 1385696-32-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 5-cyclobutyloxypyridine-3-carboxylic acid. InChIKey: NOABMRYWELEBII-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 5-cyclobutyloxypyridine-3-carboxylic acid |
| InChIKey | NOABMRYWELEBII-UHFFFAOYSA-N |
| SMILES | C1CC(C1)OC2=CN=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)