Products 1385696-53-6
CAS 1385696-53-6 appears in our catalog under these names: 4-(Cyclobutylmethoxy)pyridine-2-carboxylic acid, 95%, 4-(Cyclobutylmethoxy)picolinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-(cyclobutylmethoxy)pyridine-2-carboxylic acid (CAS 1385696-53-6) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 4-(cyclobutylmethoxy)pyridine-2-carboxylic acid. InChIKey: WHCJROVYQBRWKC-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 4-(cyclobutylmethoxy)pyridine-2-carboxylic acid |
| InChIKey | WHCJROVYQBRWKC-UHFFFAOYSA-N |
| SMILES | C1CC(C1)COC2=CC(=NC=C2)C(=O)O |
Computed by PubChem (NCBI)