Products 1385727-54-7
CAS 1385727-54-7 is the registry number for 3-Chloro-2-((2-cyanopropan-2-yl)carbamoyl)benzoic Acid. Offered by: TRC. Available pack sizes: 1g.
3-chloro-2-(2-cyanopropan-2-ylcarbamoyl)benzoic acid (CAS 1385727-54-7) is a chemical compound with the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. IUPAC name: 3-chloro-2-(2-cyanopropan-2-ylcarbamoyl)benzoic acid. InChIKey: SJFCASZILSCZOY-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O3 |
|---|---|
| Molecular weight | 266.68 g/mol |
| IUPAC name | 3-chloro-2-(2-cyanopropan-2-ylcarbamoyl)benzoic acid |
| InChIKey | SJFCASZILSCZOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)NC(=O)C1=C(C=CC=C1Cl)C(=O)O |
Computed by PubChem (NCBI)