CAS 1388043-92-2 appears in our catalog under these names: 7-Chloro-4-methyl-1h-indole-2-carboxylic acid, 95%, 7-Chloro-4-methyl-1H-indole-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-chloro-4-methyl-1H-indole-2-carboxylic acid (CAS 1388043-92-2) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 7-chloro-4-methyl-1H-indole-2-carboxylic acid. InChIKey: PJCLCYWXTKSJCN-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 7-chloro-4-methyl-1H-indole-2-carboxylic acid |
| InChIKey | PJCLCYWXTKSJCN-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(NC2=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)