Products 1390707-32-0
CAS 1390707-32-0 is the registry number for (R)-2-Amino-2-(2-bromo-4-(trifluoromethyl)phenyl)ethan-1-ol, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(2R)-2-amino-2-[2-bromo-4-(trifluoromethyl)phenyl]ethanol (CAS 1390707-32-0) is a chemical compound with the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. IUPAC name: (2R)-2-amino-2-[2-bromo-4-(trifluoromethyl)phenyl]ethanol. InChIKey: PCRQGNMBEPKXEX-QMMMGPOBSA-N.
| Molecular formula | C9H9BrF3NO |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | (2R)-2-amino-2-[2-bromo-4-(trifluoromethyl)phenyl]ethanol |
| InChIKey | PCRQGNMBEPKXEX-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)[C@H](CO)N |
Computed by PubChem (NCBI)