Products 1391051-72-1
CAS 1391051-72-1 appears in our catalog under these names: 4-Chloro Kynurenine-13C2,15N, >95% (HPLC), 4-Chloro kynurenine-13C2,15N. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-(2-amino-4-chlorophenyl)-2-(15N)azanyl-4-oxo(1,2-13C2)butanoic acid (CAS 1391051-72-1) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 245.64 g/mol. IUPAC name: 4-(2-amino-4-chlorophenyl)-2-(15N)azanyl-4-oxo(1,2-13C2)butanoic acid. InChIKey: HQLHZNDJQSRKDT-SVKOXWCPSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 245.64 g/mol |
| IUPAC name | 4-(2-amino-4-chlorophenyl)-2-(15N)azanyl-4-oxo(1,2-13C2)butanoic acid |
| InChIKey | HQLHZNDJQSRKDT-SVKOXWCPSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C(=O)C[13CH]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)