Products 175777-22-7
CAS 175777-22-7 is the registry number for (R)-4-Chlorokynurenine. Offered by: TRC. Available pack sizes: 100mg.
(2R)-2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid (CAS 175777-22-7) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: (2R)-2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid. InChIKey: HQLHZNDJQSRKDT-MRVPVSSYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | (2R)-2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid |
| InChIKey | HQLHZNDJQSRKDT-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C(=O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)