CAS 75802-84-5 appears in our catalog under these names: 4-Chloro Kynurenine, >95% (HPLC), 4-Chloro Kynurenine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 2mg, 1mg.
2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid (CAS 75802-84-5) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: 2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid. InChIKey: HQLHZNDJQSRKDT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | 2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid |
| InChIKey | HQLHZNDJQSRKDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C(=O)CC(C(=O)O)N |
Computed by PubChem (NCBI)