CAS 153152-32-0 appears in our catalog under these names: (S)-4-Chlorokynurenine, AV-101/ 98%, 4–Chlorokynurenine, AV-101 98%, (S)-4-Chlorokynurenine, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 5 mg.
(2S)-2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid (CAS 153152-32-0) is a chemical compound with the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. IUPAC name: (2S)-2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid. InChIKey: HQLHZNDJQSRKDT-QMMMGPOBSA-N.
| Molecular formula | C10H11ClN2O3 |
|---|---|
| Molecular weight | 242.66 g/mol |
| IUPAC name | (2S)-2-amino-4-(2-amino-4-chlorophenyl)-4-oxobutanoic acid |
| InChIKey | HQLHZNDJQSRKDT-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C(=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)