CAS 1391052-68-8 appears in our catalog under these names: Ketorolac Impurity 8(Ketorolac EP Impurity F), Ketorolac EP Impurity F, rac Ketorolac 7-Benzoyl Isomer. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
7-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid (CAS 1391052-68-8) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 7-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid. InChIKey: RIQZRCMKWYHMOR-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 7-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| InChIKey | RIQZRCMKWYHMOR-UHFFFAOYSA-N |
| SMILES | C1CN2C=CC(=C2C1C(=O)O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)