Products 139109-52-7
CAS 139109-52-7 is the registry number for (2Z)-3-(2-Chlorophenyl)-2-hydroxyiminopropanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2Z)-3-(2-chlorophenyl)-2-hydroxyiminopropanoic acid (CAS 139109-52-7) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: (2Z)-3-(2-chlorophenyl)-2-hydroxyiminopropanoic acid. InChIKey: KBVHACSKAHPTIM-FLIBITNWSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | (2Z)-3-(2-chlorophenyl)-2-hydroxyiminopropanoic acid |
| InChIKey | KBVHACSKAHPTIM-FLIBITNWSA-N |
| SMILES | C1=CC=C(C(=C1)C/C(=N/O)/C(=O)O)Cl |
Computed by PubChem (NCBI)