CAS 1391354-82-7 appears in our catalog under these names: (R)-1-(6-Methoxypyridin-3-yl)ethanamine hydrochloride, 98%, (R)-1-(6-Methoxypyridin-3-yl)ethanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 1g.
(1R)-1-(6-methoxy-3-pyridinyl)ethanamine;hydrochloride (CAS 1391354-82-7) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: (1R)-1-(6-methoxy-3-pyridinyl)ethanamine;hydrochloride. InChIKey: WLHLISRSTOSHBU-FYZOBXCZSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | (1R)-1-(6-methoxy-3-pyridinyl)ethanamine;hydrochloride |
| InChIKey | WLHLISRSTOSHBU-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CN=C(C=C1)OC)N.Cl |
Computed by PubChem (NCBI)