CAS 1391355-13-7 appears in our catalog under these names: (S)–1–(6–Methoxypyridin–3–yl)ethanamine hydrochloride, (S)-1-(6-Methoxypyridin-3-yl)ethanamine hydrochloride, 97%, 97%, (S)-1-(6-METHOXYPYRIDIN-3-YL)ETHANAMINE HCL, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g.
(1S)-1-(6-methoxy-3-pyridinyl)ethanamine;hydrochloride (CAS 1391355-13-7) is a chemical compound with the molecular formula C8H13ClN2O and a molecular weight of 188.65 g/mol. IUPAC name: (1S)-1-(6-methoxy-3-pyridinyl)ethanamine;hydrochloride. InChIKey: WLHLISRSTOSHBU-RGMNGODLSA-N.
| Molecular formula | C8H13ClN2O |
|---|---|
| Molecular weight | 188.65 g/mol |
| IUPAC name | (1S)-1-(6-methoxy-3-pyridinyl)ethanamine;hydrochloride |
| InChIKey | WLHLISRSTOSHBU-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CN=C(C=C1)OC)N.Cl |
Computed by PubChem (NCBI)