CAS 1391502-94-5 is the registry number for (R)–3–(2–Bromophenyl)morpholine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(3R)-3-(2-bromophenyl)morpholine;hydrochloride (CAS 1391502-94-5) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: (3R)-3-(2-bromophenyl)morpholine;hydrochloride. InChIKey: SFHWUSCPLQPIJM-PPHPATTJSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | (3R)-3-(2-bromophenyl)morpholine;hydrochloride |
| InChIKey | SFHWUSCPLQPIJM-PPHPATTJSA-N |
| SMILES | C1COC[C@H](N1)C2=CC=CC=C2Br.Cl |
Computed by PubChem (NCBI)