CAS 1391515-70-0 appears in our catalog under these names: (R)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 95%, (R)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 97%, (R)–Methyl 3–(1–amino–2–hydroxyethyl)benzoate hydrochloride, (R)-Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g.
Methyl 3-[(1R)-1-amino-2-hydroxyethyl]benzoate;hydrochloride (CAS 1391515-70-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-[(1R)-1-amino-2-hydroxyethyl]benzoate;hydrochloride. InChIKey: SWIJKZSHJUALNL-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-[(1R)-1-amino-2-hydroxyethyl]benzoate;hydrochloride |
| InChIKey | SWIJKZSHJUALNL-FVGYRXGTSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)