Products 373648-81-8
CAS 373648-81-8 appears in our catalog under these names: Methyl 3-(1-amino-2-hydroxyethyl)benzoate hcl, 98%, Methyl 3-(1-amino-2-hydroxyethyl)benzoate hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl 3-(1-amino-2-hydroxyethyl)benzoate;hydrochloride (CAS 373648-81-8) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-(1-amino-2-hydroxyethyl)benzoate;hydrochloride. InChIKey: SWIJKZSHJUALNL-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-(1-amino-2-hydroxyethyl)benzoate;hydrochloride |
| InChIKey | SWIJKZSHJUALNL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C(CO)N.Cl |
Computed by PubChem (NCBI)