CAS 1391553-17-5 appears in our catalog under these names: (1R)-1-(3-(Benzyloxy)phenyl)ethan-1-amine hydrochloride, 95%, (1R)-1-(3-(Benzyloxy)phenyl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1R)-1-(3-phenylmethoxyphenyl)ethanamine;hydrochloride (CAS 1391553-17-5) is a chemical compound with the molecular formula C15H18ClNO and a molecular weight of 263.76 g/mol. IUPAC name: (1R)-1-(3-phenylmethoxyphenyl)ethanamine;hydrochloride. InChIKey: GSMJUVHGBWUTQK-UTONKHPSSA-N.
| Molecular formula | C15H18ClNO |
|---|---|
| Molecular weight | 263.76 g/mol |
| IUPAC name | (1R)-1-(3-phenylmethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | GSMJUVHGBWUTQK-UTONKHPSSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)