Products 1392266-43-1
CAS 1392266-43-1 appears in our catalog under these names: (3R,4S)-rel-4-(2,5-Dichlorophenyl)pyrrolidine-3-carboxylic acid, 98%, 98%, (3R,4S)-4-(2,5-dichlorophenyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3R,4S)-4-(2,5-dichlorophenyl)pyrrolidine-3-carboxylic acid (CAS 1392266-43-1) is a chemical compound with the molecular formula C11H11Cl2NO2 and a molecular weight of 260.11 g/mol. IUPAC name: (3R,4S)-4-(2,5-dichlorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: VKDXYQPZUWSCKU-BDAKNGLRSA-N.
| Molecular formula | C11H11Cl2NO2 |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | (3R,4S)-4-(2,5-dichlorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | VKDXYQPZUWSCKU-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)