CAS 2091133-28-5 is the registry number for Methyl 5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylate (CAS 2091133-28-5) is a chemical compound with the molecular formula C11H11Cl2NO2 and a molecular weight of 260.11 g/mol. IUPAC name: methyl 5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylate. InChIKey: CDRZMPIBCBIOCT-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO2 |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | methyl 5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylate |
| InChIKey | CDRZMPIBCBIOCT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCNC2=C(C=CC(=C12)Cl)Cl |
Computed by PubChem (NCBI)