Products 33764-00-0
CAS 33764-00-0 is the registry number for (3,4-dichlorophenyl)(morpholin-4-yl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
(3,4-dichlorophenyl)-morpholin-4-ylmethanone (CAS 33764-00-0) is a chemical compound with the molecular formula C11H11Cl2NO2 and a molecular weight of 260.11 g/mol. IUPAC name: (3,4-dichlorophenyl)-morpholin-4-ylmethanone. InChIKey: GCHPLPHGWKAUFW-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO2 |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-morpholin-4-ylmethanone |
| InChIKey | GCHPLPHGWKAUFW-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)