CAS 1392266-51-1 is the registry number for (3R,4S)-rel-4-(2,3-Dichlorophenyl)pyrrolidine-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-(2,3-dichlorophenyl)pyrrolidine-3-carboxylic acid (CAS 1392266-51-1) is a chemical compound with the molecular formula C11H11Cl2NO2 and a molecular weight of 260.11 g/mol. IUPAC name: (3R,4S)-4-(2,3-dichlorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: OKWXYXBTTNSUBY-SFYZADRCSA-N.
| Molecular formula | C11H11Cl2NO2 |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | (3R,4S)-4-(2,3-dichlorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | OKWXYXBTTNSUBY-SFYZADRCSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)