CAS 6392-25-2 is the registry number for (2,4-Dichlorophenyl)-morpholin-4-ylmethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,4-dichlorophenyl)-morpholin-4-ylmethanone (CAS 6392-25-2) is a chemical compound with the molecular formula C11H11Cl2NO2 and a molecular weight of 260.11 g/mol. IUPAC name: (2,4-dichlorophenyl)-morpholin-4-ylmethanone. InChIKey: JXRZEDBBEPDXNP-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO2 |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-morpholin-4-ylmethanone |
| InChIKey | JXRZEDBBEPDXNP-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)