CAS 777876-30-9 is the registry number for 4-[(2,3-Dichlorophenyl)carbonyl]morpholine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,3-dichlorophenyl)-morpholin-4-ylmethanone (CAS 777876-30-9) is a chemical compound with the molecular formula C11H11Cl2NO2 and a molecular weight of 260.11 g/mol. IUPAC name: (2,3-dichlorophenyl)-morpholin-4-ylmethanone. InChIKey: VKABJKUEKXNLOH-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO2 |
|---|---|
| Molecular weight | 260.11 g/mol |
| IUPAC name | (2,3-dichlorophenyl)-morpholin-4-ylmethanone |
| InChIKey | VKABJKUEKXNLOH-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)