CAS 1393377-32-6 is the registry number for 8–Methoxybenzo(e)(1,2,3)oxathiazine 2,2–dioxide. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
8-methoxy-1,2lambda6,3-benzoxathiazine 2,2-dioxide (CAS 1393377-32-6) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 8-methoxy-1,2lambda6,3-benzoxathiazine 2,2-dioxide. InChIKey: COPOUJYJUXWYGG-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 8-methoxy-1,2lambda6,3-benzoxathiazine 2,2-dioxide |
| InChIKey | COPOUJYJUXWYGG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1OS(=O)(=O)N=C2 |
Computed by PubChem (NCBI)