Products 1393534-20-7
CAS 1393534-20-7 appears in our catalog under these names: 3-(4-Chlorophenyl)oxetane-3-carboxylic acid, 95%, 3-(4-Chlorophenyl)oxetane-3-carboxylic acid 97%, 3-(4-Chlorophenyl)oxetane-3-carboxylic acid, 97%, 97%, 3-(4-Chlorophenyl)oxetane-3-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 500mg.
3-(4-chlorophenyl)oxetane-3-carboxylic acid (CAS 1393534-20-7) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 3-(4-chlorophenyl)oxetane-3-carboxylic acid. InChIKey: LDADFEOPIIBFOJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 3-(4-chlorophenyl)oxetane-3-carboxylic acid |
| InChIKey | LDADFEOPIIBFOJ-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)