CAS 93439-37-3 appears in our catalog under these names: 6-Chloroacetyl-1,4-benzodioxane, 98%, 2-Chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone 98%, 2-Chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone, 95%, 95%, 6-Chloroacetyl-1,4-benzodioxane. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 100mg, 250mg.
2-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone (CAS 93439-37-3) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 2-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone. InChIKey: ILEYSCVQRULQKW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone |
| InChIKey | ILEYSCVQRULQKW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CCl |
Computed by PubChem (NCBI)