CAS 1266249-44-8 appears in our catalog under these names: Methyl 3-(3-chloro-4-hydroxyphenyl)acrylate, 95%, (E)-3-Chloro-4-hydroxycinnamic Acid, >95% (HPLC), (E)-3-(3-Chloro-4-hydroxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks, TRC, Ambeed. Available pack sizes: 1g, 2,5g, 250mg, 500mg, 5g.
Methyl (E)-3-(3-chloro-4-hydroxyphenyl)prop-2-enoate (CAS 1266249-44-8) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: methyl (E)-3-(3-chloro-4-hydroxyphenyl)prop-2-enoate. InChIKey: BZHVHNVZOHIELV-HWKANZROSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | methyl (E)-3-(3-chloro-4-hydroxyphenyl)prop-2-enoate |
| InChIKey | BZHVHNVZOHIELV-HWKANZROSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=C(C=C1)O)Cl |
Computed by PubChem (NCBI)