CAS 40026-24-2 appears in our catalog under these names: 6–Chlorochroman–2–carboxylic acid, 6-Chlorochroman-2-carboxylic acid, 6-Chlorochroman-2-carboxylic acid, 95%, 6-Chlorochroman-2-carboxylic acid, 97%, 6-Chlorochroman-2-carboxylic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100mg, 1000mg, 500mg, 1g, 250mg, 5g.
6-chloro-3,4-dihydro-2H-chromene-2-carboxylic acid (CAS 40026-24-2) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-chromene-2-carboxylic acid. InChIKey: UIVQVPBZOASIML-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChIKey | UIVQVPBZOASIML-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)OC1C(=O)O |
Computed by PubChem (NCBI)