CAS 900937-56-6 appears in our catalog under these names: 2-Oxopropyl 4-chlorobenzoate, 95%, 2-Oxopropyl 4-chlorobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-oxopropyl 4-chlorobenzoate (CAS 900937-56-6) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 2-oxopropyl 4-chlorobenzoate. InChIKey: MRUJKQHYYZTVCE-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-oxopropyl 4-chlorobenzoate |
| InChIKey | MRUJKQHYYZTVCE-UHFFFAOYSA-N |
| SMILES | CC(=O)COC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)