Products 49845-69-4
CAS 49845-69-4 appears in our catalog under these names: (R)-O-Acetylmandelic acid chloride, 97%, (R)-2-Chloro-2-oxo-1-phenylethyl acetate, 97%, (R)-2-Chloro-2-oxo-1-phenylethyl acetate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.
2-(2-acetylphenyl)-2-hydroxyacetyl chloride (CAS 49845-69-4) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 2-(2-acetylphenyl)-2-hydroxyacetyl chloride. InChIKey: KZKKRAVNYHSDCG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-(2-acetylphenyl)-2-hydroxyacetyl chloride |
| InChIKey | KZKKRAVNYHSDCG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1C(C(=O)Cl)O |
Computed by PubChem (NCBI)