CAS 108704-93-4 appears in our catalog under these names: (2,3-Dihydro-benzo[1,4]dioxin-6-yl)-acetyl chloride, 95%, 2-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)acetyl chloride, 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl chloride (CAS 108704-93-4) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl chloride. InChIKey: UYLGKTHYKDXIHC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl chloride |
| InChIKey | UYLGKTHYKDXIHC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)CC(=O)Cl |
Computed by PubChem (NCBI)