Products 108704-93-4

CAS 108704-93-4 appears in our catalog under these names: (2,3-Dihydro-benzo[1,4]dioxin-6-yl)-acetyl chloride, 95%, 2-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)acetyl chloride, 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.

Structural formula: {0} (CAS {1})

2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl chloride (CAS 108704-93-4) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl chloride. InChIKey: UYLGKTHYKDXIHC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClO3
Molecular weight212.63 g/mol
IUPAC name2-(2,3-dihydro-1,4-benzodioxin-6-yl)acetyl chloride
InChIKeyUYLGKTHYKDXIHC-UHFFFAOYSA-N
SMILESC1COC2=C(O1)C=CC(=C2)CC(=O)Cl

Computed by PubChem (NCBI)