Products 1394021-15-8

CAS 1394021-15-8 is the registry number for 6-(2-Aminoethoxy)nicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-(2-aminoethoxy)pyridine-3-carboxylic acid (CAS 1394021-15-8) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 6-(2-aminoethoxy)pyridine-3-carboxylic acid. InChIKey: CFXQQHVJGLNWBY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O3
Molecular weight182.18 g/mol
IUPAC name6-(2-aminoethoxy)pyridine-3-carboxylic acid
InChIKeyCFXQQHVJGLNWBY-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C(=O)O)OCCN

Computed by PubChem (NCBI)