Products 1394899-62-7
CAS 1394899-62-7 is the registry number for 2',3',5',6'-Tetramethyl-[1,1':4',1''-Terphenyl]-4,4''-Dicarboxylic Acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(4-carboxyphenyl)-2,3,5,6-tetramethylphenyl]benzoic acid (CAS 1394899-62-7) is a chemical compound with the molecular formula C24H22O4 and a molecular weight of 374.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,3,5,6-tetramethylphenyl]benzoic acid. InChIKey: PVMJNMJOZSBUHM-UHFFFAOYSA-N.
| Molecular formula | C24H22O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,3,5,6-tetramethylphenyl]benzoic acid |
| InChIKey | PVMJNMJOZSBUHM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C2=CC=C(C=C2)C(=O)O)C)C)C3=CC=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)