CAS 13949-49-0 is the registry number for 2-Amino-2′,5-dichlorobenzophenone oxime. Offered by: TRC. Available pack sizes: 100mg.
N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methylidene]hydroxylamine (CAS 13949-49-0) is a chemical compound with the molecular formula C13H10Cl2N2O and a molecular weight of 281.13 g/mol. IUPAC name: N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methylidene]hydroxylamine. InChIKey: LOSSBMNCLJUFRY-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methylidene]hydroxylamine |
| InChIKey | LOSSBMNCLJUFRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=NO)C2=C(C=CC(=C2)Cl)N)Cl |
Computed by PubChem (NCBI)